| Name |
7-Chloro-4,5-dihydro-5-oxothieno[3,2-b]pyridine-6-carboxylic acid
|
| Molecular Formula |
C8H4ClNO3S
|
| Molecular Weight |
229.64
|
| Smiles |
O=C(O)c1c(Cl)c2sccc2[nH]c1=O
|
O=C(O)c1c(Cl)c2sccc2[nH]c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.