| Name |
3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-ol
|
| Molecular Formula |
C8H5ClN2O2
|
| Molecular Weight |
196.59
|
| Smiles |
O=c1[nH]c(-c2cccc(Cl)c2)no1
|
O=c1[nH]c(-c2cccc(Cl)c2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.