| Name |
1,4-Pentanediamine, N4-(4,5-dihydro-4,4-dimethyl-2-thiazolyl)-N1,N1-diethyl-
|
| Molecular Formula |
C14H29N3S
|
| Molecular Weight |
271.47
|
| Smiles |
CCN(CC)CCCC(C)N=C1NC(C)(C)CS1
|
CCN(CC)CCCC(C)N=C1NC(C)(C)CS1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.