| Name |
2-Amino-4-(1,3-benzodioxol-5-yl)-4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)but-1-ene-1,1,3-tricarbonitrile;N,N-diethylethanamine
|
| Molecular Formula |
C26H31N5O6
|
| Molecular Weight |
509.6
|
| Smiles |
CC1(C)OC(=O)C(C(c2ccc3c(c2)OCO3)C(C#N)C(N)=C(C#N)C#N)C(=O)O1.CCN(CC)CC
|
CC1(C)OC(=O)C(C(c2ccc3c(c2)OCO3)C(C#N)C(N)=C(C#N)C#N)C(=O)O1.CCN(CC)CC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.