| Name |
DI-Tert-butyl 6-methyl-1,4-diazepane-1,4-dicarboxylate
|
| Molecular Formula |
C16H30N2O4
|
| Molecular Weight |
314.42
|
| Smiles |
CC1CN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C1
|
CC1CN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.