| Name |
(3Ar,6aR)-5-methylsulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid
|
| Molecular Formula |
C8H13NO5S
|
| Molecular Weight |
235.26
|
| Smiles |
CS(=O)(=O)N1CC2COCC2(C(=O)O)C1
|
CS(=O)(=O)N1CC2COCC2(C(=O)O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.