| Name |
5-amino-3-({[1-(4-chlorophenyl)-1H-tetrazol-5-yl]methyl}sulfanyl)[1,2,4]triazolo[4,3-a]pyrimidin-7-ol
|
| Molecular Formula |
C13H10ClN9OS
|
| Molecular Weight |
375.80
|
| Smiles |
Nc1cc(=O)[nH]c2nnc(SCc3nnnn3-c3ccc(Cl)cc3)n12
|
Nc1cc(=O)[nH]c2nnc(SCc3nnnn3-c3ccc(Cl)cc3)n12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.