| Name |
Lithium 3-methyl-3H-imidazo[4,5-b]pyridine-2-carboxylate
|
| Molecular Formula |
C8H6LiN3O2
|
| Molecular Weight |
183.1
|
| Smiles |
Cn1c(C(=O)[O-])nc2cccnc21.[Li+]
|
Cn1c(C(=O)[O-])nc2cccnc21.[Li+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.