| Name |
N4-(5-fluoropyridin-2-yl)-N6,N6-dimethylpyrimidine-4,6-diamine
|
| Molecular Formula |
C11H12FN5
|
| Molecular Weight |
233.24
|
| Smiles |
CN(C)c1cc(Nc2ccc(F)cn2)ncn1
|
CN(C)c1cc(Nc2ccc(F)cn2)ncn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.