| Name |
2-(Azetidin-3-yl)-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid
|
| Molecular Formula |
C10H13F6N3O4
|
| Molecular Weight |
353.22
|
| Smiles |
C1CNC(C2CNC2)=N1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
|
C1CNC(C2CNC2)=N1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.