| Name |
3-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid
|
| Molecular Formula |
C13H20F3N3O5
|
| Molecular Weight |
355.31
|
| Smiles |
CC(C)(CN1CC2CNCCN2C1=O)C(=O)O.O=C(O)C(F)(F)F
|
CC(C)(CN1CC2CNCCN2C1=O)C(=O)O.O=C(O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.