| Name |
7-Benzyl-4-(2-morpholinoethyl)-1,2,6,7,8,9-hexahydroimidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(4H)-one
|
| Molecular Formula |
C22H29N5O2
|
| Molecular Weight |
395.5
|
| Smiles |
O=C1C2=C(CCN(Cc3ccccc3)C2)N2CCN=C2N1CCN1CCOCC1
|
O=C1C2=C(CCN(Cc3ccccc3)C2)N2CCN=C2N1CCN1CCOCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.