| Name |
2-{3H-imidazo[4,5-c]pyridin-2-yl}propan-1-amine dihydrochloride
|
| Molecular Formula |
C9H14Cl2N4
|
| Molecular Weight |
249.14
|
| Smiles |
CC(CN)c1nc2ccncc2[nH]1.Cl.Cl
|
CC(CN)c1nc2ccncc2[nH]1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.