| Name |
Methyl 6-hydroxy-2'-(trifluoromethoxy)-[1,1'-biphenyl]-3-carboxylate
|
| Molecular Formula |
C15H11F3O4
|
| Molecular Weight |
312.24
|
| Smiles |
COC(=O)c1ccc(O)c(-c2ccccc2OC(F)(F)F)c1
|
COC(=O)c1ccc(O)c(-c2ccccc2OC(F)(F)F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.