| Name |
8-methyl-5H-pyridazino[4,5-b]indole-4-thiol
|
| Molecular Formula |
C11H9N3S
|
| Molecular Weight |
215.28
|
| Smiles |
Cc1ccc2[nH]c3c(=S)[nH]ncc3c2c1
|
Cc1ccc2[nH]c3c(=S)[nH]ncc3c2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.