| Name |
Ethyl 7-iodo-1-methyl-2,4-dioxo-1,2,3,4-tetrahydroquinoline-3-carboxylate
|
| Molecular Formula |
C13H12INO4
|
| Molecular Weight |
373.14
|
| Smiles |
CCOC(=O)C1C(=O)c2ccc(I)cc2N(C)C1=O
|
CCOC(=O)C1C(=O)c2ccc(I)cc2N(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.