| Name |
2-(Aminomethyl)-2-fluoro-3-{spiro[3.3]heptan-2-yl}propan-1-amine dihydrochloride
|
| Molecular Formula |
C11H23Cl2FN2
|
| Molecular Weight |
273.22
|
| Smiles |
Cl.Cl.NCC(F)(CN)CC1CC2(CCC2)C1
|
Cl.Cl.NCC(F)(CN)CC1CC2(CCC2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.