| Name |
2-((2,2-Dimethyl-2,3-dihydrobenzofuran-7-yl)oxy)-1-(3-((6-ethyl-5-fluoropyrimidin-4-yl)oxy)pyrrolidin-1-yl)ethanone
|
| Molecular Formula |
C22H26FN3O4
|
| Molecular Weight |
415.5
|
| Smiles |
CCc1ncnc(OC2CCN(C(=O)COc3cccc4c3OC(C)(C)C4)C2)c1F
|
CCc1ncnc(OC2CCN(C(=O)COc3cccc4c3OC(C)(C)C4)C2)c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.