| Name |
3-bromo-1-(3,5-difluorophenyl)-1H-1,2,4-triazole
|
| Molecular Formula |
C8H4BrF2N3
|
| Molecular Weight |
260.04
|
| Smiles |
Fc1cc(F)cc(-n2cnc(Br)n2)c1
|
Fc1cc(F)cc(-n2cnc(Br)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.