| Name |
4-(3,5-Dichloro-4-methoxy-2,6-dimethylphenyl)-2,5-diiodo-3-thiophenecarboxylic acid ethyl ester
|
| Molecular Formula |
C16H14Cl2I2O3S
|
| Molecular Weight |
611.1
|
| Smiles |
CCOC(=O)c1c(I)sc(I)c1-c1c(C)c(Cl)c(OC)c(Cl)c1C
|
CCOC(=O)c1c(I)sc(I)c1-c1c(C)c(Cl)c(OC)c(Cl)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.