| Name |
N-{1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-4-yl}-6-(trifluoromethyl)pyrimidin-4-amine
|
| Molecular Formula |
C14H17F3N6O
|
| Molecular Weight |
342.32
|
| Smiles |
Cc1nc(CN2CCC(Nc3cc(C(F)(F)F)ncn3)CC2)no1
|
Cc1nc(CN2CCC(Nc3cc(C(F)(F)F)ncn3)CC2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.