| Name |
4-(4-{6-Tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl}piperidin-1-yl)-3-chloropyridine
|
| Molecular Formula |
C19H23ClN6
|
| Molecular Weight |
370.9
|
| Smiles |
CC(C)(C)c1ccc2nnc(C3CCN(c4ccncc4Cl)CC3)n2n1
|
CC(C)(C)c1ccc2nnc(C3CCN(c4ccncc4Cl)CC3)n2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.