| Name |
N,4-dimethyl-N-(1-{[1,2,4]triazolo[4,3-b]pyridazin-6-yl}azetidin-3-yl)pyrimidin-2-amine
|
| Molecular Formula |
C14H16N8
|
| Molecular Weight |
296.33
|
| Smiles |
Cc1ccnc(N(C)C2CN(c3ccc4nncn4n3)C2)n1
|
Cc1ccnc(N(C)C2CN(c3ccc4nncn4n3)C2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.