| Name |
N-methyl-N-{pyrido[3,4-d]pyrimidin-4-yl}-1-{[1,2,4]triazolo[4,3-b]pyridazin-6-yl}azetidin-3-amine
|
| Molecular Formula |
C16H15N9
|
| Molecular Weight |
333.35
|
| Smiles |
CN(c1ncnc2cnccc12)C1CN(c2ccc3nncn3n2)C1
|
CN(c1ncnc2cnccc12)C1CN(c2ccc3nncn3n2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.