| Name |
1-{4-[5-(Trifluoromethyl)-1,3,4-thiadiazol-2-yl]-1,4-diazepan-1-yl}prop-2-en-1-one
|
| Molecular Formula |
C11H13F3N4OS
|
| Molecular Weight |
306.31
|
| Smiles |
C=CC(=O)N1CCCN(c2nnc(C(F)(F)F)s2)CC1
|
C=CC(=O)N1CCCN(c2nnc(C(F)(F)F)s2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.