| Name |
1-{3-[3-(Thiophen-2-yl)-1,2,4-oxadiazol-5-yl]morpholin-4-yl}prop-2-en-1-one
|
| Molecular Formula |
C13H13N3O3S
|
| Molecular Weight |
291.33
|
| Smiles |
C=CC(=O)N1CCOCC1c1nc(-c2cccs2)no1
|
C=CC(=O)N1CCOCC1c1nc(-c2cccs2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.