| Name |
1-{3,4-Dihydrospiro[1-benzopyran-2,3'-pyrrolidine]-1'-yl}prop-2-en-1-one
|
| Molecular Formula |
C15H17NO2
|
| Molecular Weight |
243.30
|
| Smiles |
C=CC(=O)N1CCC2(CCc3ccccc3O2)C1
|
C=CC(=O)N1CCC2(CCc3ccccc3O2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.