| Name |
4-(3-(Pyridin-4-yl)-1H-1,2,4-triazol-5-yl)picolinimidohydrazide
|
| Molecular Formula |
C13H12N8
|
| Molecular Weight |
280.29
|
| Smiles |
NN=C(N)c1cc(-c2n[nH]c(-c3ccncc3)n2)ccn1
|
NN=C(N)c1cc(-c2n[nH]c(-c3ccncc3)n2)ccn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.