| Name |
(2,9-Di-tert-butyl-12H-6,12-methanodibenzo[d,g][1,3]dioxocin-4-yl)diphenylphosphine
|
| Molecular Formula |
C35H37O2P
|
| Molecular Weight |
520.6
|
| Smiles |
CC(C)(C)c1ccc2c(c1)OC1CC2c2cc(C(C)(C)C)cc(P(c3ccccc3)c3ccccc3)c2O1
|
CC(C)(C)c1ccc2c(c1)OC1CC2c2cc(C(C)(C)C)cc(P(c3ccccc3)c3ccccc3)c2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.