| Name |
N-(2-{[2,3'-bithiophene]-5-yl}-2-hydroxyethyl)-3-methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-5-sulfonamide
|
| Molecular Formula |
C18H16N2O5S3
|
| Molecular Weight |
436.5
|
| Smiles |
Cn1c(=O)oc2ccc(S(=O)(=O)NCC(O)c3ccc(-c4ccsc4)s3)cc21
|
Cn1c(=O)oc2ccc(S(=O)(=O)NCC(O)c3ccc(-c4ccsc4)s3)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.