| Name |
10(1H)-Acridineacetic acid, 9-(5-bromo-2-hydroxyphenyl)-2,3,4,5,6,7,8,9-octahydro-1,8-dioxo-
|
| Molecular Formula |
C21H20BrNO5
|
| Molecular Weight |
446.3
|
| Smiles |
O=C(O)CN1C2=C(C(=O)CCC2)C(c2cc(Br)ccc2O)C2=C1CCCC2=O
|
O=C(O)CN1C2=C(C(=O)CCC2)C(c2cc(Br)ccc2O)C2=C1CCCC2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.