| Name |
Fmoc-D-homoArg(Z)2-OH
|
| Molecular Formula |
C38H38N4O8
|
| Molecular Weight |
678.7
|
| Smiles |
O=C(NC(=NCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)NC(=O)OCc1ccccc1)OCc1ccccc1
|
O=C(NC(=NCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)NC(=O)OCc1ccccc1)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.