| Name |
Ethyl 5-(2-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylate
|
| Molecular Formula |
C14H14FN3O2
|
| Molecular Weight |
275.28
|
| Smiles |
CCOC(=O)c1nc2n(n1)C(c1ccccc1F)CC2
|
CCOC(=O)c1nc2n(n1)C(c1ccccc1F)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.