| Name |
N-[3-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]carbamic acid 2-propen-1-yl ester
|
| Molecular Formula |
C13H13Cl2N3O2
|
| Molecular Weight |
314.16
|
| Smiles |
C=CCOC(=O)NC1CNN=C1c1ccc(Cl)c(Cl)c1
|
C=CCOC(=O)NC1CNN=C1c1ccc(Cl)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.