| Name |
5-methyl-N-{[3-(pyridin-4-yl)pyrazin-2-yl]methyl}-1,2-oxazole-3-carboxamide
|
| Molecular Formula |
C15H13N5O2
|
| Molecular Weight |
295.30
|
| Smiles |
Cc1cc(C(=O)NCc2nccnc2-c2ccncc2)no1
|
Cc1cc(C(=O)NCc2nccnc2-c2ccncc2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.