| Name |
N-(2-fluorocyclopentyl)-5H,6H,7H-pyrazolo[3,2-b][1,3]oxazine-2-carboxamide
|
| Molecular Formula |
C12H16FN3O2
|
| Molecular Weight |
253.27
|
| Smiles |
O=C(NC1CCCC1F)c1cc2n(n1)CCCO2
|
O=C(NC1CCCC1F)c1cc2n(n1)CCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.