| Name |
Spiro[morpholine-2,6a(2)(7a(2)H)-[5H]pyrrolo[1,2-c]imidazole]-1a(2),4-dicarboxylic acid, 4-(1,1-dimethylethyl) ester
|
| Molecular Formula |
C15H21N3O5
|
| Molecular Weight |
323.34
|
| Smiles |
CC(C)(C)OC(=O)N1CCOC2(Cc3c(C(=O)O)ncn3C2)C1
|
CC(C)(C)OC(=O)N1CCOC2(Cc3c(C(=O)O)ncn3C2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.