| Name |
6-cyclopropyl-3-[(1-{1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl}piperidin-4-yl)methyl]-3,4-dihydropyrimidin-4-one
|
| Molecular Formula |
C19H23N7O
|
| Molecular Weight |
365.4
|
| Smiles |
Cn1ncc2c(N3CCC(Cn4cnc(C5CC5)cc4=O)CC3)ncnc21
|
Cn1ncc2c(N3CCC(Cn4cnc(C5CC5)cc4=O)CC3)ncnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.