| Name |
(R)-tert-butyl (3-(5-(2,5-difluorophenyl)-3-(methoxy(methyl)carbamoyl)-2-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)propyl)carbamate
|
| Molecular Formula |
C25H30F2N4O4S
|
| Molecular Weight |
520.6
|
| Smiles |
CON(C)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCCNC(=O)OC(C)(C)C)c1ccccc1
|
CON(C)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCCNC(=O)OC(C)(C)C)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.