| Name |
N-methyl-N-{5-methylpyrazolo[1,5-a]pyrimidin-7-yl}-1-{[1,2,4]triazolo[4,3-b]pyridazin-6-yl}azetidin-3-amine
|
| Molecular Formula |
C16H17N9
|
| Molecular Weight |
335.37
|
| Smiles |
Cc1cc(N(C)C2CN(c3ccc4nncn4n3)C2)n2nccc2n1
|
Cc1cc(N(C)C2CN(c3ccc4nncn4n3)C2)n2nccc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.