| Name |
1-{5'-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4,5-dihydro-1,2-thiazol-3-yl]-3'H-spiro[azetidine-3,1'-[2]benzofuran]-1-yl}-3,3,3-trifluoropropan-1-one
|
| Molecular Formula |
C23H15Cl2F7N2O2S
|
| Molecular Weight |
587.3
|
| Smiles |
O=C(CC(F)(F)F)N1CC2(C1)OCc1cc(C3=NSC(c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)ccc12
|
O=C(CC(F)(F)F)N1CC2(C1)OCc1cc(C3=NSC(c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)ccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.