| Name |
2-(6-fluoro-3-methyl-2,2-dioxidobenzo[c][1,2,5]thiadiazol-1(3H)-yl)-1-morpholinoethanone
|
| Molecular Formula |
C13H16FN3O4S
|
| Molecular Weight |
329.35
|
| Smiles |
CN1c2ccc(F)cc2N(CC(=O)N2CCOCC2)S1(=O)=O
|
CN1c2ccc(F)cc2N(CC(=O)N2CCOCC2)S1(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.