| Name |
4-cyclopropyl-2-methyltetrahydropyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione
|
| Molecular Formula |
C10H14N2O2
|
| Molecular Weight |
194.23
|
| Smiles |
CN1C(=O)C2CNC(C3CC3)C2C1=O
|
CN1C(=O)C2CNC(C3CC3)C2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.