| Name |
(2Z)-3-(2H-1,3-benzodioxol-5-yl)-N-(2-{2-methyl-4-oxo-3H,4H-thieno[2,3-d]pyrimidin-3-yl}ethyl)prop-2-enamide
|
| Molecular Formula |
C19H17N3O4S
|
| Molecular Weight |
383.4
|
| Smiles |
Cc1nc2sccc2c(=O)n1CCNC(=O)C=Cc1ccc2c(c1)OCO2
|
Cc1nc2sccc2c(=O)n1CCNC(=O)C=Cc1ccc2c(c1)OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.