| Name |
2-Amino-5,6,7,8-tetrahydro-6-propyl-thiazolo(4',5':5,4)thieno(2,3-c)pyridine dihydrochloride
|
| Molecular Formula |
C11H17Cl2N3S2
|
| Molecular Weight |
326.3
|
| Smiles |
CCCN1CCc2c(sc3sc(N)nc23)C1.Cl.Cl
|
CCCN1CCc2c(sc3sc(N)nc23)C1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.