| Name |
3-(4-(2-(2,6-Dimethylphenyl)-4,5-dihydrooxazol-4-yl)phenyl)-5-phenyl-4,5-dihydroisoxazole
|
| Molecular Formula |
C26H24N2O2
|
| Molecular Weight |
396.5
|
| Smiles |
Cc1cccc(C)c1C1=NC(c2ccc(C3=NOC(c4ccccc4)C3)cc2)CO1
|
Cc1cccc(C)c1C1=NC(c2ccc(C3=NOC(c4ccccc4)C3)cc2)CO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.