| Name |
methyl 1-(4-chloro-2-methoxy-5-methylphenyl)-1H-1,2,3-triazole-4-carboxylate
|
| Molecular Formula |
C12H12ClN3O3
|
| Molecular Weight |
281.69
|
| Smiles |
COC(=O)c1cn(-c2cc(C)c(Cl)cc2OC)nn1
|
COC(=O)c1cn(-c2cc(C)c(Cl)cc2OC)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.