| Name |
4-Chloro-7-oxo-7H,8H-pyrido[2,3-d]pyrimidine-6-carbonitrile
|
| Molecular Formula |
C8H3ClN4O
|
| Molecular Weight |
206.59
|
| Smiles |
N#Cc1cc2c(Cl)ncnc2[nH]c1=O
|
N#Cc1cc2c(Cl)ncnc2[nH]c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.