| Name |
Benzothiazole, 2-bromo-4,5,6,7-tetrafluoro-
|
| Molecular Formula |
C7BrF4NS
|
| Molecular Weight |
286.05
|
| Smiles |
Fc1c(F)c(F)c2sc(Br)nc2c1F
|
Fc1c(F)c(F)c2sc(Br)nc2c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.