| Name |
2-butyl-3-[(E)-2-[(3E)-3-{2-[(3E)-2-butyl-2-azatricyclo[6.3.1.0^{4,12}]dodeca-1(12),4,6,8,10-pentaen-3-ylidene]ethylidene}-2-phenylcyclopent-1-en-1-yl]ethenyl]-2-azatricyclo[6.3.1.0^{4,12}]dodeca-1(11),2,4(12),5,7,9-hexaen-2-ium; trifluoro[(trifluorometha
|
| Molecular Formula |
C47H43F6N3O4S2
|
| Molecular Weight |
892.0
|
| Smiles |
CCCCn1c(=CC=C2CCC(C=CC3=[N+](CCCC)c4cccc5cccc3c45)=C2c2ccccc2)c2cccc3cccc1c32.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F
|
CCCCn1c(=CC=C2CCC(C=CC3=[N+](CCCC)c4cccc5cccc3c45)=C2c2ccccc2)c2cccc3cccc1c32.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.